C33H37N3O4 — CID 135528147
[(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-(4-methoxy-N-propylanilino)-3-oxopropanoate (PubChem CID 135528147) has the molecular formula C33H37N3O4 and a molecular weight of 539.68 g/mol. Its IUPAC name is [(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-(4-methoxy-N-propylanilino)-3-oxopropanoate.
| Compound Name | [(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-(4-methoxy-N-propylanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 135528147 |
| Molecular Formula | C33H37N3O4 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | [(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-(4-methoxy-N-propylanilino)-3-oxopropanoate |
| SMILES | CCCN(C(=O)C(=[N+]=[N-])C(=O)O[C@H]1[C@@H]2CC[C@](C)([C@H]1c1ccc3ccccc3c1)C2(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H37N3O4/c1-6-19-36(24-13-15-25(39-5)16-14-24)30(37)28(35-34)31(38)40-29-26-17-18-33(4,32(26,2)3)27(29)23-12-11-21-9-7-8-10-22(21)20-23/h7-16,20,26-27,29H,6,17-19H2,1-5H3/t26-,27-,29-,33+/m0/s1 |
| InChIKey | PHNGBZHAQLDDOY-POCMPZBTSA-N |
| XLogP | 6.41 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|