C36H38N4O12 — CID 135528222
(5S,13S)-19-[(2,4-dinitrophenyl)diazenyl]-5,13-bis(4-methoxyphenyl)-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol (PubChem CID 135528222) has the molecular formula C36H38N4O12 and a molecular weight of 718.72 g/mol. Its IUPAC name is (5S,13S)-19-[(2,4-dinitrophenyl)diazenyl]-5,13-bis(4-methoxyphenyl)-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol.
| Compound Name | (5S,13S)-19-[(2,4-dinitrophenyl)diazenyl]-5,13-bis(4-methoxyphenyl)-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol |
|---|---|
| PubChem CID | 135528222 |
| Molecular Formula | C36H38N4O12 |
| Molecular Weight | 718.72 g/mol |
| Exact Mass | 718.25 |
| IUPAC Name | (5S,13S)-19-[(2,4-dinitrophenyl)diazenyl]-5,13-bis(4-methoxyphenyl)-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol |
| SMILES | COc1ccc([C@H]2COCc3cc(/N=N/c4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc(c3O)COC[C@H](c3ccc(OC)cc3)OCCOCCO2)cc1 |
| InChI | InChI=1S/C36H38N4O12/c1-46-30-8-3-24(4-9-30)34-22-49-20-26-17-28(37-38-32-12-7-29(39(42)43)19-33(32)40(44)45)18-27(36(26)41)21-50-23-35(52-16-14-48-13-15-51-34)25-5-10-31(47-2)11-6-25/h3-12,17-19,34-35,41H,13-16,20-23H2,1-2H3/b38-37+/t34-,35-/m1/s1 |
| InChIKey | GODNQOFMHBLCEZ-FAKMJZSLSA-N |
| XLogP | 7.22 |
| TPSA | 195.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.72 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|