C11H9Cl2N3OS — CID 135528450
(2Z)-2-[(E)-(2,6-dichlorophenyl)methylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one (PubChem CID 135528450) has the molecular formula C11H9Cl2N3OS and a molecular weight of 302.19 g/mol. Its IUPAC name is (2Z)-2-[(E)-(2,6-dichlorophenyl)methylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(E)-(2,6-dichlorophenyl)methylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135528450 |
| Molecular Formula | C11H9Cl2N3OS |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | (2Z)-2-[(E)-(2,6-dichlorophenyl)methylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one |
| SMILES | CC1S/C(=N\N=C\c2c(Cl)cccc2Cl)NC1=O |
| InChI | InChI=1S/C11H9Cl2N3OS/c1-6-10(17)15-11(18-6)16-14-5-7-8(12)3-2-4-9(7)13/h2-6H,1H3,(H,15,16,17)/b14-5+ |
| InChIKey | CQQRMHQLMOLZBW-LHHJGKSTSA-N |
| XLogP | 2.93 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|