C27H33ClN6O2 — CID 135528485
(20S)-20-benzyl-25-chloro-1,4,13,18,21,23-hexazatricyclo[20.3.1.06,11]hexacosa-6,8,10,22,24-pentaene-3,26-dione (PubChem CID 135528485) has the molecular formula C27H33ClN6O2 and a molecular weight of 509.05 g/mol. Its IUPAC name is (20S)-20-benzyl-25-chloro-1,4,13,18,21,23-hexazatricyclo[20.3.1.06,11]hexacosa-6,8,10,22,24-pentaene-3,26-dione.
| Compound Name | (20S)-20-benzyl-25-chloro-1,4,13,18,21,23-hexazatricyclo[20.3.1.06,11]hexacosa-6,8,10,22,24-pentaene-3,26-dione |
|---|---|
| PubChem CID | 135528485 |
| Molecular Formula | C27H33ClN6O2 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (20S)-20-benzyl-25-chloro-1,4,13,18,21,23-hexazatricyclo[20.3.1.06,11]hexacosa-6,8,10,22,24-pentaene-3,26-dione |
| SMILES | O=C1Cn2c(Cl)cnc(c2=O)N[C@@H](Cc2ccccc2)CNCCCCNCc2ccccc2CN1 |
| InChI | InChI=1S/C27H33ClN6O2/c28-24-18-32-26-27(36)34(24)19-25(35)31-16-22-11-5-4-10-21(22)15-29-12-6-7-13-30-17-23(33-26)14-20-8-2-1-3-9-20/h1-5,8-11,18,23,29-30H,6-7,12-17,19H2,(H,31,35)(H,32,33)/t23-/m0/s1 |
| InChIKey | XYHOPCIUIJZGAQ-QHCPKHFHSA-N |
| XLogP | 2.71 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |