C28H33F3N8O4 — CID 135528541
3-amino-N-[(2R)-butan-2-yl]-5-[1-[2-[(4-carbamimidoyl-2,3,6-trifluoro-5-hydroxyphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzamide (PubChem CID 135528541) has the molecular formula C28H33F3N8O4 and a molecular weight of 602.62 g/mol. Its IUPAC name is 3-amino-N-[(2R)-butan-2-yl]-5-[1-[2-[(4-carbamimidoyl-2,3,6-trifluoro-5-hydroxyphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzamide.
| Compound Name | 3-amino-N-[(2R)-butan-2-yl]-5-[1-[2-[(4-carbamimidoyl-2,3,6-trifluoro-5-hydroxyphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 135528541 |
| Molecular Formula | C28H33F3N8O4 |
| Molecular Weight | 602.62 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | 3-amino-N-[(2R)-butan-2-yl]-5-[1-[2-[(4-carbamimidoyl-2,3,6-trifluoro-5-hydroxyphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzamide |
| SMILES | [H]/N=C(\N)c1c(O)c(F)c(CNC(=O)Cn2c(-c3cc(N)cc(C(=O)N[C@H](C)CC)c3)cnc(NC(C)C)c2=O)c(F)c1F |
| InChI | InChI=1S/C28H33F3N8O4/c1-5-13(4)38-27(42)15-6-14(7-16(32)8-15)18-10-36-26(37-12(2)3)28(43)39(18)11-19(40)35-9-17-21(29)23(31)20(25(33)34)24(41)22(17)30/h6-8,10,12-13,41H,5,9,11,32H2,1-4H3,(H3,33,34)(H,35,40)(H,36,37)(H,38,42)/t13-/m1/s1 |
| InChIKey | VRDFUSKFRMWIRI-CYBMUJFWSA-N |
| XLogP | 2.56 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|