C18H12N2O2S — CID 135528630
3-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one (PubChem CID 135528630) has the molecular formula C18H12N2O2S and a molecular weight of 320.37 g/mol. Its IUPAC name is 3-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one.
| Compound Name | 3-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135528630 |
| Molecular Formula | C18H12N2O2S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 3-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1-c1csc(-c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C18H12N2O2S/c21-13-7-5-11(6-8-13)18-20-16(10-23-18)14-9-12-3-1-2-4-15(12)19-17(14)22/h1-10,21H,(H,19,22) |
| InChIKey | PTAPBELLLOUDLL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |