C16H19N5O3 — CID 135528631
tert-butyl 8-cyano-3-oxo-1,4,6,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),5,8-triene-12-carboxylate (PubChem CID 135528631) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is tert-butyl 8-cyano-3-oxo-1,4,6,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),5,8-triene-12-carboxylate.
| Compound Name | tert-butyl 8-cyano-3-oxo-1,4,6,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),5,8-triene-12-carboxylate |
|---|---|
| PubChem CID | 135528631 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | tert-butyl 8-cyano-3-oxo-1,4,6,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),5,8-triene-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(C#N)c3nc[nH]c(=O)c3n2CC1 |
| InChI | InChI=1S/C16H19N5O3/c1-16(2,3)24-15(23)20-5-4-11-10(8-17)12-13(21(11)7-6-20)14(22)19-9-18-12/h9H,4-7H2,1-3H3,(H,18,19,22) |
| InChIKey | MWQXZXURECZLNK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |