C28H28N2O2 — CID 135528785
12-(benzyliminomethyl)-6-butyl-5,6-dihydroindolo[2,1-a]isoquinoline-3,9-diol (PubChem CID 135528785) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 12-(benzyliminomethyl)-6-butyl-5,6-dihydroindolo[2,1-a]isoquinoline-3,9-diol.
| Compound Name | 12-(benzyliminomethyl)-6-butyl-5,6-dihydroindolo[2,1-a]isoquinoline-3,9-diol |
|---|---|
| PubChem CID | 135528785 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 12-(benzyliminomethyl)-6-butyl-5,6-dihydroindolo[2,1-a]isoquinoline-3,9-diol |
| SMILES | CCCCC1Cc2cc(O)ccc2-c2c(/C=N/Cc3ccccc3)c3ccc(O)cc3n21 |
| InChI | InChI=1S/C28H28N2O2/c1-2-3-9-21-14-20-15-22(31)10-12-24(20)28-26(18-29-17-19-7-5-4-6-8-19)25-13-11-23(32)16-27(25)30(21)28/h4-8,10-13,15-16,18,21,31-32H,2-3,9,14,17H2,1H3/b29-18+ |
| InChIKey | YJKGELOHOBRULU-RDRPBHBLSA-N |
| XLogP | 6.63 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|