C17H12FN3OS — CID 135529249
5-(1-benzofuran-2-yl)-N-(4-fluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135529249) has the molecular formula C17H12FN3OS and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-N-(4-fluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(1-benzofuran-2-yl)-N-(4-fluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135529249 |
| Molecular Formula | C17H12FN3OS |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-N-(4-fluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Fc1ccc(/N=C2/NN=C(c3cc4ccccc4o3)CS2)cc1 |
| InChI | InChI=1S/C17H12FN3OS/c18-12-5-7-13(8-6-12)19-17-21-20-14(10-23-17)16-9-11-3-1-2-4-15(11)22-16/h1-9H,10H2,(H,19,21) |
| InChIKey | MVGOGOOXLJWVHB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|