C23H22F6N5O6P — CID 135529404
[3-[[(2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-oxo-2-phenylpiperazin-1-yl]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]phosphonic acid (PubChem CID 135529404) has the molecular formula C23H22F6N5O6P and a molecular weight of 609.42 g/mol. Its IUPAC name is [3-[[(2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-oxo-2-phenylpiperazin-1-yl]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]phosphonic acid.
| Compound Name | [3-[[(2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-oxo-2-phenylpiperazin-1-yl]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 135529404 |
| Molecular Formula | C23H22F6N5O6P |
| Molecular Weight | 609.42 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | [3-[[(2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-oxo-2-phenylpiperazin-1-yl]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]phosphonic acid |
| SMILES | O=C1CN(Cc2nn(P(=O)(O)O)c(=O)[nH]2)[C@@H](c2ccccc2)[C@@H](COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C23H22F6N5O6P/c24-22(25,26)15-6-13(7-16(8-15)23(27,28)29)11-40-12-17-20(14-4-2-1-3-5-14)33(10-19(35)30-17)9-18-31-21(36)34(32-18)41(37,38)39/h1-8,17,20H,9-12H2,(H,30,35)(H,31,32,36)(H2,37,38,39)/t17-,20+/m1/s1 |
| InChIKey | TXGQDUZZIPYIAQ-XLIONFOSSA-N |
| XLogP | 2.81 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|