About CID 135529406
CID 135529406 (PubChem CID 135529406) has the molecular formula C72H80N8O2Si3
and a molecular weight of 1173.74 g/mol.
Molecular Properties
| Compound Name | CID 135529406 |
| PubChem CID | 135529406 |
| Molecular Formula | C72H80N8O2Si3 |
| Molecular Weight | 1173.74 g/mol |
| Exact Mass | 1172.57 |
| IUPAC Name | — |
| SMILES | CC(C)C[Si](CC(C)C)(CC(C)C)O[Si]O[Si](CC(C)C)(CC(C)C)CC(C)C.c1ccc2cc3c(cc2c1)-c1nc-3nc2[nH]c(nc3nc(nc4[nH]c(n1)c1cc5ccccc5cc41)-c1cc4ccccc4cc1-3)c1cc3ccccc3cc21 |
| InChI | InChI=1S/C48H26N8.C24H54O2Si3/c1-2-10-26-18-34-33(17-25(26)9-1)41-49-42(34)54-44-37-21-29-13-5-6-14-30(29)22-38(37)46(51-44)56-48-40-24-32-16-8-7-15-31(32)23-39(40)47(52-48)55-45-36-20-28-12-4-3-11-27(28)19-35(36)43(50-45)53-41;1-19(2)13-28(14-20(3)4,15-21(5)6)25-27-26-29(16-22(7)8,17-23(9)10)18-24(11)12/h1-24H,(H2,49,50,51,52,53,54,55,56);19-24H,13-18H2,1-12H3 |
| InChIKey | KTGOKALVQGYBID-UHFFFAOYSA-N |
| XLogP | 19.86 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 85 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1173.74 |
| LogP ≤ 5 | 19.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 135529406 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135529406?
The IUPAC name of CID 135529406 (CID 135529406) is not available.
What is the SMILES notation for CID 135529406?
The canonical SMILES for CID 135529406 is CC(C)C[Si](CC(C)C)(CC(C)C)O[Si]O[Si](CC(C)C)(CC(C)C)CC(C)C.c1ccc2cc3c(cc2c1)-c1nc-3nc2[nH]c(nc3nc(nc4[nH]c(n1)c1cc5ccccc5cc41)-c1cc4ccccc4cc1-3)c1cc3ccccc3cc21.
What is the InChIKey of CID 135529406?
The InChIKey is KTGOKALVQGYBID-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H26N8.C24H54O2Si3/c1-2-10-26-18-34-33(17-25(26)9-1)41-49-42(34)54-44-37-21-29-13-5-6-14-30(29)22-38(37)46(51-44)56-48-40-24-32-16-8-7-15-31(32)23-39(40)47(52-48)55-45-36-20-28-12-4-3-11-27(28)19-35(36)43(50-45)53-41;1-19(2)13-28(14-20(3)4,15-21(5)6)25-27-26-29(16-22(7)8,17-23(9)10)18-24(11)12/h1-24H,(H2,49,50,51,52,53,54,55,56);19-24H,13-18H2,1-12H3.
What are the key properties of CID 135529406?
CID 135529406 has a molecular weight of 1173.74 g/mol, XLogP of 19.86, 16 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135529406 is sourced from PubChem (CID 135529406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).