About 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one
2-(2-propoxyphenyl)-1,7-dihydropurin-6-one (PubChem CID 135529458) has the molecular formula C14H14N4O2
and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one |
| PubChem CID | 135529458 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one |
| SMILES | CCCOc1ccccc1-c1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H14N4O2/c1-2-7-20-10-6-4-3-5-9(10)12-17-13-11(14(19)18-12)15-8-16-13/h3-6,8H,2,7H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | PQTJTRTXCNZDFT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one?
The IUPAC name of 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one (CID 135529458) is 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one.
What is the SMILES notation for 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one?
The canonical SMILES for 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one is CCCOc1ccccc1-c1nc2nc[nH]c2c(=O)[nH]1.
What is the InChIKey of 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one?
The InChIKey is PQTJTRTXCNZDFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O2/c1-2-7-20-10-6-4-3-5-9(10)12-17-13-11(14(19)18-12)15-8-16-13/h3-6,8H,2,7H2,1H3,(H2,15,16,17,18,19).
What are the key properties of 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one?
2-(2-propoxyphenyl)-1,7-dihydropurin-6-one has a molecular weight of 270.29 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propoxyphenyl)-1,7-dihydropurin-6-one is sourced from PubChem (CID 135529458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).