C11H9F4N3O2 — CID 135529713
2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-4H-1,2,4-triazol-3-one (PubChem CID 135529713) has the molecular formula C11H9F4N3O2 and a molecular weight of 291.20 g/mol. Its IUPAC name is 2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-4H-1,2,4-triazol-3-one.
| Compound Name | 2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 135529713 |
| Molecular Formula | C11H9F4N3O2 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-4H-1,2,4-triazol-3-one |
| SMILES | O=c1[nH]cnn1-c1ccc(OCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H9F4N3O2/c12-9(13)11(14,15)5-20-8-3-1-7(2-4-8)18-10(19)16-6-17-18/h1-4,6,9H,5H2,(H,16,17,19) |
| InChIKey | SEWXTTZABCAQNE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|