C26H27NO — CID 135529812
6-[C-methyl-N-[(1S)-1-phenylethyl]carbonimidoyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol (PubChem CID 135529812) has the molecular formula C26H27NO and a molecular weight of 369.51 g/mol. Its IUPAC name is 6-[C-methyl-N-[(1S)-1-phenylethyl]carbonimidoyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol.
| Compound Name | 6-[C-methyl-N-[(1S)-1-phenylethyl]carbonimidoyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol |
|---|---|
| PubChem CID | 135529812 |
| Molecular Formula | C26H27NO |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 6-[C-methyl-N-[(1S)-1-phenylethyl]carbonimidoyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol |
| SMILES | C/C(=N\[C@@H](C)c1ccccc1)c1c2ccc(c1O)CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C26H27NO/c1-18(22-6-4-3-5-7-22)27-19(2)25-23-14-12-20-8-10-21(11-9-20)13-15-24(17-16-23)26(25)28/h3-11,16-18,28H,12-15H2,1-2H3/b27-19+/t18-/m0/s1 |
| InChIKey | SJAPKZSNWWIRHP-GICFLYKWSA-N |
| XLogP | 5.85 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|