About 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione
2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione (PubChem CID 135530051) has the molecular formula C8H11N5O4
and a molecular weight of 241.21 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione.
Molecular Properties
| Compound Name | 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione |
| PubChem CID | 135530051 |
| Molecular Formula | C8H11N5O4 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione |
| SMILES | Nc1nc2c([nH]c(=O)n2COCCO)c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N5O4/c9-7-11-5-4(6(15)12-7)10-8(16)13(5)3-17-2-1-14/h14H,1-3H2,(H,10,16)(H3,9,11,12,15) |
| InChIKey | PTSDSAPWOJZBNX-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 139.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione?
The IUPAC name of 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione (CID 135530051) is 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione.
What is the SMILES notation for 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione?
The canonical SMILES for 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione is Nc1nc2c([nH]c(=O)n2COCCO)c(=O)[nH]1.
What is the InChIKey of 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione?
The InChIKey is PTSDSAPWOJZBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O4/c9-7-11-5-4(6(15)12-7)10-8(16)13(5)3-17-2-1-14/h14H,1-3H2,(H,10,16)(H3,9,11,12,15).
What are the key properties of 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione?
2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione has a molecular weight of 241.21 g/mol, XLogP of -2.04, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(2-hydroxyethoxymethyl)-1,7-dihydropurine-6,8-dione is sourced from PubChem (CID 135530051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).