C44H22Cl4F4N4 — CID 135530179
5,10,15,20-tetrakis(2-chloro-6-fluorophenyl)-21,23-dihydroporphyrin (PubChem CID 135530179) has the molecular formula C44H22Cl4F4N4 and a molecular weight of 824.49 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2-chloro-6-fluorophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2-chloro-6-fluorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135530179 |
| Molecular Formula | C44H22Cl4F4N4 |
| Molecular Weight | 824.49 g/mol |
| Exact Mass | 822.05 |
| IUPAC Name | 5,10,15,20-tetrakis(2-chloro-6-fluorophenyl)-21,23-dihydroporphyrin |
| SMILES | Fc1cccc(Cl)c1-c1c2nc(c(-c3c(F)cccc3Cl)c3ccc([nH]3)c(-c3c(F)cccc3Cl)c3nc(c(-c4c(F)cccc4Cl)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C44H22Cl4F4N4/c45-21-5-1-9-25(49)37(21)41-29-13-15-31(53-29)42(38-22(46)6-2-10-26(38)50)33-17-19-35(55-33)44(40-24(48)8-4-12-28(40)52)36-20-18-34(56-36)43(32-16-14-30(41)54-32)39-23(47)7-3-11-27(39)51/h1-20,53,56H/b41-29+,41-30+,42-31+,42-33+,43-32+,43-34+,44-35+,44-36+ |
| InChIKey | QNPJMSKJUBRGKT-DSIMAETFSA-N |
| XLogP | 14.49 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.49 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |