C19H22N2O4S — CID 135530389
butyl 2-hydroxy-6-methyl-4-oxo-3-(pyridine-3-carbothioyliminomethyl)hepta-2,5-dienoate (PubChem CID 135530389) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is butyl 2-hydroxy-6-methyl-4-oxo-3-(pyridine-3-carbothioyliminomethyl)hepta-2,5-dienoate.
| Compound Name | butyl 2-hydroxy-6-methyl-4-oxo-3-(pyridine-3-carbothioyliminomethyl)hepta-2,5-dienoate |
|---|---|
| PubChem CID | 135530389 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | butyl 2-hydroxy-6-methyl-4-oxo-3-(pyridine-3-carbothioyliminomethyl)hepta-2,5-dienoate |
| SMILES | CCCCOC(=O)C(O)=C(/C=N/C(=S)c1cccnc1)C(=O)C=C(C)C |
| InChI | InChI=1S/C19H22N2O4S/c1-4-5-9-25-19(24)17(23)15(16(22)10-13(2)3)12-21-18(26)14-7-6-8-20-11-14/h6-8,10-12,23H,4-5,9H2,1-3H3/b17-15?,21-12+ |
| InChIKey | KXUZENOWHUGQGZ-MZSYWWAYSA-N |
| XLogP | 3.52 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|