C30H37N7O6S — CID 135530760
(2S)-3-[6-[(E)-3-[[N'-(3,4-dihydro-2H-pyrrol-5-yl)carbamimidoyl]amino]oxyprop-1-enyl]-4-oxo-3H-quinazolin-2-yl]-2-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid (PubChem CID 135530760) has the molecular formula C30H37N7O6S and a molecular weight of 623.74 g/mol. Its IUPAC name is (2S)-3-[6-[(E)-3-[[N'-(3,4-dihydro-2H-pyrrol-5-yl)carbamimidoyl]amino]oxyprop-1-enyl]-4-oxo-3H-quinazolin-2-yl]-2-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[6-[(E)-3-[[N'-(3,4-dihydro-2H-pyrrol-5-yl)carbamimidoyl]amino]oxyprop-1-enyl]-4-oxo-3H-quinazolin-2-yl]-2-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 135530760 |
| Molecular Formula | C30H37N7O6S |
| Molecular Weight | 623.74 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | (2S)-3-[6-[(E)-3-[[N'-(3,4-dihydro-2H-pyrrol-5-yl)carbamimidoyl]amino]oxyprop-1-enyl]-4-oxo-3H-quinazolin-2-yl]-2-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N[C@@H](Cc2nc3ccc(/C=C/CON/C(N)=N/C4=NCCC4)cc3c(=O)[nH]2)C(=O)O)c(C)c1C |
| InChI | InChI=1S/C30H37N7O6S/c1-16-17(2)19(4)27(20(5)18(16)3)44(41,42)37-24(29(39)40)15-26-33-23-11-10-21(14-22(23)28(38)34-26)8-7-13-43-36-30(31)35-25-9-6-12-32-25/h7-8,10-11,14,24,37H,6,9,12-13,15H2,1-5H3,(H,39,40)(H,33,34,38)(H3,31,32,35,36)/b8-7+/t24-/m0/s1 |
| InChIKey | ZAELFBSDZQOJBN-UROCCOEBSA-N |
| XLogP | 2.48 |
| TPSA | 201.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|