About 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one
2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one (PubChem CID 135530844) has the molecular formula C23H24N4O
and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one |
| PubChem CID | 135530844 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(N2CCC(N3CC=C(c4ccccc4)CC3)C2)nc2ccccc12 |
| InChI | InChI=1S/C23H24N4O/c28-22-20-8-4-5-9-21(20)24-23(25-22)27-15-12-19(16-27)26-13-10-18(11-14-26)17-6-2-1-3-7-17/h1-10,19H,11-16H2,(H,24,25,28) |
| InChIKey | GMELGVOWUOVYSE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one?
The IUPAC name of 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one (CID 135530844) is 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one.
What is the SMILES notation for 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one?
The canonical SMILES for 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one is O=c1[nH]c(N2CCC(N3CC=C(c4ccccc4)CC3)C2)nc2ccccc12.
What is the InChIKey of 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one?
The InChIKey is GMELGVOWUOVYSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O/c28-22-20-8-4-5-9-21(20)24-23(25-22)27-15-12-19(16-27)26-13-10-18(11-14-26)17-6-2-1-3-7-17/h1-10,19H,11-16H2,(H,24,25,28).
What are the key properties of 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one?
2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one has a molecular weight of 372.47 g/mol, XLogP of 3.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pyrrolidin-1-yl]-3H-quinazolin-4-one is sourced from PubChem (CID 135530844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).