About 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one
3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one (PubChem CID 135531176) has the molecular formula C18H12ClN3O2
and a molecular weight of 337.77 g/mol. Its IUPAC name is 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one |
| PubChem CID | 135531176 |
| Molecular Formula | C18H12ClN3O2 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one |
| SMILES | Nc1cc(-c2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)on1 |
| InChI | InChI=1S/C18H12ClN3O2/c19-11-6-7-13-12(8-11)16(10-4-2-1-3-5-10)17(18(23)21-13)14-9-15(20)22-24-14/h1-9H,(H2,20,22)(H,21,23) |
| InChIKey | RXDHJXUKBGSFRS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one?
The IUPAC name of 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one (CID 135531176) is 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one.
What is the SMILES notation for 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one?
The canonical SMILES for 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one is Nc1cc(-c2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)on1.
What is the InChIKey of 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one?
The InChIKey is RXDHJXUKBGSFRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClN3O2/c19-11-6-7-13-12(8-11)16(10-4-2-1-3-5-10)17(18(23)21-13)14-9-15(20)22-24-14/h1-9H,(H2,20,22)(H,21,23).
What are the key properties of 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one?
3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one has a molecular weight of 337.77 g/mol, XLogP of 4.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1,2-oxazol-5-yl)-6-chloro-4-phenyl-1H-quinolin-2-one is sourced from PubChem (CID 135531176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).