C16H17N3O4S — CID 135531185
ethyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate (PubChem CID 135531185) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is ethyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 135531185 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | ethyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(Sc1nnc(Cc2ccccc2)c(=O)[nH]1)C(C)=O |
| InChI | InChI=1S/C16H17N3O4S/c1-3-23-15(22)13(10(2)20)24-16-17-14(21)12(18-19-16)9-11-7-5-4-6-8-11/h4-8,13H,3,9H2,1-2H3,(H,17,19,21) |
| InChIKey | OTEKGYDVLPHFEU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|