C17H12BrN3O3S — CID 135531870
[4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 135531870) has the molecular formula C17H12BrN3O3S and a molecular weight of 418.27 g/mol. Its IUPAC name is [4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 135531870 |
| Molecular Formula | C17H12BrN3O3S |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | [4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | O=C1CSC(=NN=Cc2ccc(OC(=O)c3ccc(Br)cc3)cc2)N1 |
| InChI | InChI=1S/C17H12BrN3O3S/c18-13-5-3-12(4-6-13)16(23)24-14-7-1-11(2-8-14)9-19-21-17-20-15(22)10-25-17/h1-9H,10H2,(H,20,21,22) |
| InChIKey | KUCPJWIYCPYDFB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|