About N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine
N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine (PubChem CID 135531979) has the molecular formula C6H9N3O3
and a molecular weight of 171.16 g/mol. Its IUPAC name is N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine |
| PubChem CID | 135531979 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine |
| SMILES | ON=C1CCCC(=NO)C1=NO |
| InChI | InChI=1S/C6H9N3O3/c10-7-4-2-1-3-5(8-11)6(4)9-12/h10-12H,1-3H2 |
| InChIKey | GKXJWSZPLIKUPS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine?
The IUPAC name of N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine (CID 135531979) is N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine.
What is the SMILES notation for N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine?
The canonical SMILES for N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine is ON=C1CCCC(=NO)C1=NO.
What is the InChIKey of N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine?
The InChIKey is GKXJWSZPLIKUPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3/c10-7-4-2-1-3-5(8-11)6(4)9-12/h10-12H,1-3H2.
What are the key properties of N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine?
N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine has a molecular weight of 171.16 g/mol, XLogP of 0.66, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,3-bis(hydroxyimino)cyclohexylidene]hydroxylamine is sourced from PubChem (CID 135531979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).