C21H13N7O4S — CID 135531991
(1,3-dioxoisoindol-2-yl)methyl 2-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ylsulfanyl)acetate (PubChem CID 135531991) has the molecular formula C21H13N7O4S and a molecular weight of 459.45 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ylsulfanyl)acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 135531991 |
| Molecular Formula | C21H13N7O4S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-(8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ylsulfanyl)acetate |
| SMILES | O=C(CSc1nnc2nc3[nH]c4ccccc4c3nn12)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H13N7O4S/c29-15(32-10-27-18(30)11-5-1-2-6-12(11)19(27)31)9-33-21-25-24-20-23-17-16(26-28(20)21)13-7-3-4-8-14(13)22-17/h1-8H,9-10H2,(H,22,23,24) |
| InChIKey | DNPLUZFGSXNDQV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|