C21H21N3O5S — CID 135532798
4-hydroxy-3-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)quinolin-2-one (PubChem CID 135532798) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 4-hydroxy-3-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)quinolin-2-one.
| Compound Name | 4-hydroxy-3-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)quinolin-2-one |
|---|---|
| PubChem CID | 135532798 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 4-hydroxy-3-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)quinolin-2-one |
| SMILES | CC(C)CCn1c(=O)c(C2=NS(=O)(=O)c3cc(O)ccc3N2)c(O)c2ccccc21 |
| InChI | InChI=1S/C21H21N3O5S/c1-12(2)9-10-24-16-6-4-3-5-14(16)19(26)18(21(24)27)20-22-15-8-7-13(25)11-17(15)30(28,29)23-20/h3-8,11-12,25-26H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | SOFODHQSYAYGOB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|