C8H8N4O3 — CID 135533208
6-methoxy-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine (PubChem CID 135533208) has the molecular formula C8H8N4O3 and a molecular weight of 208.18 g/mol. Its IUPAC name is 6-methoxy-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine.
| Compound Name | 6-methoxy-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
|---|---|
| PubChem CID | 135533208 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 6-methoxy-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
| SMILES | COc1ccc2c(c1)[n+]([O-])c(N)n[n+]2[O-] |
| InChI | InChI=1S/C8H8N4O3/c1-15-5-2-3-6-7(4-5)11(13)8(9)10-12(6)14/h2-4H,1H3,(H2,9,10) |
| InChIKey | DWXUPPMNVGGYRX-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|