C26H23N3O5S — CID 135533537
2-[2-[[3,4-bis(phenylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135533537) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is 2-[2-[[3,4-bis(phenylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[3,4-bis(phenylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135533537 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-[2-[[3,4-bis(phenylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)NC1=O |
| InChI | InChI=1S/C26H23N3O5S/c30-24(31)14-23-25(32)28-26(35-23)29-27-15-20-11-12-21(33-16-18-7-3-1-4-8-18)22(13-20)34-17-19-9-5-2-6-10-19/h1-13,15,23H,14,16-17H2,(H,30,31)(H,28,29,32) |
| InChIKey | GPIYXRPTGOTLRF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|