About (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one
(4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 135533680) has the molecular formula C19H18N2O4
and a molecular weight of 338.36 g/mol. Its IUPAC name is (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one.
Molecular Properties
| Compound Name | (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one |
| PubChem CID | 135533680 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | COc1cc(/C=C2/C(=O)N(c3ccccc3)N=C2C)cc(OC)c1O |
| InChI | InChI=1S/C19H18N2O4/c1-12-15(19(23)21(20-12)14-7-5-4-6-8-14)9-13-10-16(24-2)18(22)17(11-13)25-3/h4-11,22H,1-3H3/b15-9+ |
| InChIKey | IPQASVQJNAYICK-OQLLNIDSSA-N |
| XLogP | 3.22 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one?
The IUPAC name of (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one (CID 135533680) is (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one.
What is the SMILES notation for (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one?
The canonical SMILES for (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one is COc1cc(/C=C2/C(=O)N(c3ccccc3)N=C2C)cc(OC)c1O.
What is the InChIKey of (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one?
The InChIKey is IPQASVQJNAYICK-OQLLNIDSSA-N. The full InChI is InChI=1S/C19H18N2O4/c1-12-15(19(23)21(20-12)14-7-5-4-6-8-14)9-13-10-16(24-2)18(22)17(11-13)25-3/h4-11,22H,1-3H3/b15-9+.
What are the key properties of (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one?
(4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one has a molecular weight of 338.36 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one is sourced from PubChem (CID 135533680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).