C24H19N5O5S — CID 135533998
2-[[3-[4-(1H-benzimidazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]phenyl]sulfonylamino]benzoic acid (PubChem CID 135533998) has the molecular formula C24H19N5O5S and a molecular weight of 489.51 g/mol. Its IUPAC name is 2-[[3-[4-(1H-benzimidazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[3-[4-(1H-benzimidazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 135533998 |
| Molecular Formula | C24H19N5O5S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-[[3-[4-(1H-benzimidazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]phenyl]sulfonylamino]benzoic acid |
| SMILES | [H]/N=C1/C(c2nc3ccccc3[nH]2)=C(O)CN1c1cccc(S(=O)(=O)Nc2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C24H19N5O5S/c25-22-21(23-26-18-10-3-4-11-19(18)27-23)20(30)13-29(22)14-6-5-7-15(12-14)35(33,34)28-17-9-2-1-8-16(17)24(31)32/h1-12,25,28,30H,13H2,(H,26,27)(H,31,32)/b25-22- |
| InChIKey | PWGPUNWDNYLQBF-LVWGJNHUSA-N |
| XLogP | 3.83 |
| TPSA | 159.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|