About 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide
5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide (PubChem CID 135534457) has the molecular formula C22H19IN2O
and a molecular weight of 454.31 g/mol. Its IUPAC name is 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide.
Molecular Properties
| Compound Name | 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide |
| PubChem CID | 135534457 |
| Molecular Formula | C22H19IN2O |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide |
| SMILES | Cc1ccc2c(ccc(/C=C/c3ccc(O)c4ncccc34)[n+]2C)c1.[I-] |
| InChI | InChI=1S/C22H18N2O.HI/c1-15-5-11-20-17(14-15)7-10-18(24(20)2)9-6-16-8-12-21(25)22-19(16)4-3-13-23-22;/h3-14H,1-2H3;1H |
| InChIKey | PWPXDRWDJIJHLD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 37.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide?
The IUPAC name of 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide (CID 135534457) is 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide.
What is the SMILES notation for 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide?
The canonical SMILES for 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide is Cc1ccc2c(ccc(/C=C/c3ccc(O)c4ncccc34)[n+]2C)c1.[I-].
What is the InChIKey of 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide?
The InChIKey is PWPXDRWDJIJHLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O.HI/c1-15-5-11-20-17(14-15)7-10-18(24(20)2)9-6-16-8-12-21(25)22-19(16)4-3-13-23-22;/h3-14H,1-2H3;1H.
What are the key properties of 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide?
5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide has a molecular weight of 454.31 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]quinolin-8-ol iodide is sourced from PubChem (CID 135534457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).