sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one

C5H4N4NaO+ — CID 135534565

IUPACsodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one
SMILESO=c1[nH]cnc2[nH]ncc12.[Na+]
InChIInChI=1S/C5H4N4O.Na/c10-5-3-1-8-9-4(3)6-2-7-5;/h1-2H,(H2,6,7,8,9,10);/q;+1
InChIKeyPTJRZVJXXNYNLN-UHFFFAOYSA-N
MW159.10 g/mol
LogP-3.35
Rot. Bonds

About sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one

sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135534565) has the molecular formula C5H4N4NaO+ and a molecular weight of 159.10 g/mol. Its IUPAC name is sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.

Molecular Properties

Compound Namesodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one
PubChem CID135534565
Molecular FormulaC5H4N4NaO+
Molecular Weight159.10 g/mol
Exact Mass159.03
IUPAC Namesodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one
SMILESO=c1[nH]cnc2[nH]ncc12.[Na+]
InChIInChI=1S/C5H4N4O.Na/c10-5-3-1-8-9-4(3)6-2-7-5;/h1-2H,(H2,6,7,8,9,10);/q;+1
InChIKeyPTJRZVJXXNYNLN-UHFFFAOYSA-N
XLogP-3.35
TPSA74.43 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.10
LogP ≤ 5-3.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (CID 135534565) is sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one is O=c1[nH]cnc2[nH]ncc12.[Na+].
What is the InChIKey of sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is PTJRZVJXXNYNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O.Na/c10-5-3-1-8-9-4(3)6-2-7-5;/h1-2H,(H2,6,7,8,9,10);/q;+1.
What are the key properties of sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 159.10 g/mol, XLogP of -3.35, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 135534565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).