About 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol
4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol (PubChem CID 1355348) has the molecular formula C23H20N2O3
and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol |
| PubChem CID | 1355348 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc(OC)c1O |
| InChI | InChI=1S/C23H20N2O3/c1-27-18-13-17(14-19(28-2)22(18)26)23-24-20(15-9-5-3-6-10-15)21(25-23)16-11-7-4-8-12-16/h3-14,26H,1-2H3,(H,24,25) |
| InChIKey | GWQSXPMDIQADHQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol?
The IUPAC name of 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol (CID 1355348) is 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol.
What is the SMILES notation for 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol?
The canonical SMILES for 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol is COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc(OC)c1O.
What is the InChIKey of 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol?
The InChIKey is GWQSXPMDIQADHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O3/c1-27-18-13-17(14-19(28-2)22(18)26)23-24-20(15-9-5-3-6-10-15)21(25-23)16-11-7-4-8-12-16/h3-14,26H,1-2H3,(H,24,25).
What are the key properties of 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol?
4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol has a molecular weight of 372.42 g/mol, XLogP of 5.13, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-diphenyl-1H-imidazol-2-yl)-2,6-dimethoxyphenol is sourced from PubChem (CID 1355348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).