C25H22BrN3O2S — CID 135535013
5-(3-bromophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135535013) has the molecular formula C25H22BrN3O2S and a molecular weight of 508.44 g/mol. Its IUPAC name is 5-(3-bromophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-(3-bromophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135535013 |
| Molecular Formula | C25H22BrN3O2S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 5-(3-bromophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | Cc1ccc(CSc2nc3c(c(=O)[nH]2)C(c2cccc(Br)c2)C2=C(CCCC2=O)N3)cc1 |
| InChI | InChI=1S/C25H22BrN3O2S/c1-14-8-10-15(11-9-14)13-32-25-28-23-22(24(31)29-25)20(16-4-2-5-17(26)12-16)21-18(27-23)6-3-7-19(21)30/h2,4-5,8-12,20H,3,6-7,13H2,1H3,(H2,27,28,29,31) |
| InChIKey | ZGBRJPHIQLLBMQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |