C31H35N11O6S — CID 135535805
3-[bis[2-hydroxy-5-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenyl]methylidene]-N,N-bis(2-methoxyethyl)cyclohexa-1,5-diene-1-sulfonamide (PubChem CID 135535805) has the molecular formula C31H35N11O6S and a molecular weight of 689.76 g/mol. Its IUPAC name is 3-[bis[2-hydroxy-5-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenyl]methylidene]-N,N-bis(2-methoxyethyl)cyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | 3-[bis[2-hydroxy-5-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenyl]methylidene]-N,N-bis(2-methoxyethyl)cyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 135535805 |
| Molecular Formula | C31H35N11O6S |
| Molecular Weight | 689.76 g/mol |
| Exact Mass | 689.25 |
| IUPAC Name | 3-[bis[2-hydroxy-5-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenyl]methylidene]-N,N-bis(2-methoxyethyl)cyclohexa-1,5-diene-1-sulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)C1=CC(=C(c2cc(/C=N/n3nnnc3C)ccc2O)c2cc(/C=N/n3nnnc3C)ccc2O)CC=C1 |
| InChI | InChI=1S/C31H35N11O6S/c1-21-34-36-38-41(21)32-19-23-8-10-29(43)27(16-23)31(28-17-24(9-11-30(28)44)20-33-42-22(2)35-37-39-42)25-6-5-7-26(18-25)49(45,46)40(12-14-47-3)13-15-48-4/h5,7-11,16-20,43-44H,6,12-15H2,1-4H3/b32-19+,33-20+ |
| InChIKey | PNYZGAFFQMXMPA-CRDPYYQKSA-N |
| XLogP | 2.02 |
| TPSA | 208.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.76 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|