About 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one
1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135535880) has the molecular formula C7H6N4O2
and a molecular weight of 178.15 g/mol. Its IUPAC name is 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 135535880 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC(=O)n1ncc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C7H6N4O2/c1-4(12)11-6-5(2-10-11)7(13)9-3-8-6/h2-3H,1H3,(H,8,9,13) |
| InChIKey | HBVOLZAKVSHTFL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 135535880) is 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one is CC(=O)n1ncc2c(=O)[nH]cnc21.
What is the InChIKey of 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is HBVOLZAKVSHTFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O2/c1-4(12)11-6-5(2-10-11)7(13)9-3-8-6/h2-3H,1H3,(H,8,9,13).
What are the key properties of 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 178.15 g/mol, XLogP of -0.22, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 135535880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).