About 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one
7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 135535894) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 135535894 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c(CC3CCCC3)c[nH]c12 |
| InChI | InChI=1S/C12H15N3O/c16-12-11-10(14-7-15-12)9(6-13-11)5-8-3-1-2-4-8/h6-8,13H,1-5H2,(H,14,15,16) |
| InChIKey | LUYOAOZVQYOVFL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The IUPAC name of 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (CID 135535894) is 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one is O=c1[nH]cnc2c(CC3CCCC3)c[nH]c12.
What is the InChIKey of 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The InChIKey is LUYOAOZVQYOVFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c16-12-11-10(14-7-15-12)9(6-13-11)5-8-3-1-2-4-8/h6-8,13H,1-5H2,(H,14,15,16).
What are the key properties of 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one has a molecular weight of 217.27 g/mol, XLogP of 1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(cyclopentylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 135535894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).