C40H52CoN2O6 — CID 135536080
cobalt;cyclopentyl (E)-2-[[(1S,2S)-2-[[(E)-2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene]amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-hydroxybut-2-enoate (PubChem CID 135536080) has the molecular formula C40H52CoN2O6 and a molecular weight of 715.80 g/mol. Its IUPAC name is cobalt;cyclopentyl (E)-2-[[(1S,2S)-2-[[(E)-2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene]amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-hydroxybut-2-enoate.
| Compound Name | cobalt;cyclopentyl (E)-2-[[(1S,2S)-2-[[(E)-2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene]amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135536080 |
| Molecular Formula | C40H52CoN2O6 |
| Molecular Weight | 715.80 g/mol |
| Exact Mass | 715.32 |
| IUPAC Name | cobalt;cyclopentyl (E)-2-[[(1S,2S)-2-[[(E)-2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene]amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-hydroxybut-2-enoate |
| SMILES | C/C(O)=C(/C=N\[C@@H](c1c(C)cc(C)cc1C)[C@@H](/N=C\C(C(=O)OC1CCCC1)=C(\C)O)c1c(C)cc(C)cc1C)C(=O)OC1CCCC1.[Co] |
| InChI | InChI=1S/C40H52N2O6.Co/c1-23-17-25(3)35(26(4)18-23)37(41-21-33(29(7)43)39(45)47-31-13-9-10-14-31)38(36-27(5)19-24(2)20-28(36)6)42-22-34(30(8)44)40(46)48-32-15-11-12-16-32;/h17-22,31-32,37-38,43-44H,9-16H2,1-8H3;/b33-29+,34-30+,41-21-,42-22-;/t37-,38-;/m0./s1 |
| InChIKey | MTUYOLQLSPBGAV-PBIVZZNKSA-N |
| XLogP | 9.09 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.80 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|