C9H11N5O2 — CID 135536117
5-N,5-N-dimethyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3,5-diamine (PubChem CID 135536117) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 5-N,5-N-dimethyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3,5-diamine.
| Compound Name | 5-N,5-N-dimethyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3,5-diamine |
|---|---|
| PubChem CID | 135536117 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 5-N,5-N-dimethyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3,5-diamine |
| SMILES | CN(C)c1cccc2c1[n+]([O-])c(N)n[n+]2[O-] |
| InChI | InChI=1S/C9H11N5O2/c1-12(2)6-4-3-5-7-8(6)13(15)9(10)11-14(7)16/h3-5H,1-2H3,(H2,10,11) |
| InChIKey | FWYDFMDCCNLWRS-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|