About (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine
(NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine (PubChem CID 135536526) has the molecular formula C12H12N4O
and a molecular weight of 228.26 g/mol. Its IUPAC name is (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine |
| PubChem CID | 135536526 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine |
| SMILES | O/N=C1/CCCc2nn(-c3ccccc3)nc21 |
| InChI | InChI=1S/C12H12N4O/c17-15-11-8-4-7-10-12(11)14-16(13-10)9-5-2-1-3-6-9/h1-3,5-6,17H,4,7-8H2/b15-11- |
| InChIKey | OBUYPANMZNFRGC-PTNGSMBKSA-N |
| XLogP | 1.78 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine?
The IUPAC name of (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine (CID 135536526) is (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine.
What is the SMILES notation for (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine?
The canonical SMILES for (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine is O/N=C1/CCCc2nn(-c3ccccc3)nc21.
What is the InChIKey of (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine?
The InChIKey is OBUYPANMZNFRGC-PTNGSMBKSA-N. The full InChI is InChI=1S/C12H12N4O/c17-15-11-8-4-7-10-12(11)14-16(13-10)9-5-2-1-3-6-9/h1-3,5-6,17H,4,7-8H2/b15-11-.
What are the key properties of (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine?
(NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine has a molecular weight of 228.26 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(2-phenyl-6,7-dihydro-5H-benzotriazol-4-ylidene)hydroxylamine is sourced from PubChem (CID 135536526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).