C13H13N3O2 — CID 135536636
ethyl 5,6-dihydropyrazolo[1,5-c]quinazoline-2-carboxylate (PubChem CID 135536636) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is ethyl 5,6-dihydropyrazolo[1,5-c]quinazoline-2-carboxylate.
| Compound Name | ethyl 5,6-dihydropyrazolo[1,5-c]quinazoline-2-carboxylate |
|---|---|
| PubChem CID | 135536636 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | ethyl 5,6-dihydropyrazolo[1,5-c]quinazoline-2-carboxylate |
| SMILES | CCOC(=O)c1cc2n(n1)CNc1ccccc1-2 |
| InChI | InChI=1S/C13H13N3O2/c1-2-18-13(17)11-7-12-9-5-3-4-6-10(9)14-8-16(12)15-11/h3-7,14H,2,8H2,1H3 |
| InChIKey | WBXBPNDEYXGELR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |