C12H11N5O — CID 135536638
2-amino-7-[(2,4,5,6-tetradeuterio-3-pyridinyl)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 135536638) has the molecular formula C12H11N5O and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-amino-7-[(2,4,5,6-tetradeuterio-3-pyridinyl)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-[(2,4,5,6-tetradeuterio-3-pyridinyl)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135536638 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-amino-7-[(2,4,5,6-tetradeuterio-3-pyridinyl)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | [2H]c1nc([2H])c(Cc2c[nH]c3c(=O)[nH]c(N)nc23)c([2H])c1[2H] |
| InChI | InChI=1S/C12H11N5O/c13-12-16-9-8(4-7-2-1-3-14-5-7)6-15-10(9)11(18)17-12/h1-3,5-6,15H,4H2,(H3,13,16,17,18)/i1D,2D,3D,5D |
| InChIKey | DOHVAKFYAHLCJP-RZIJKAHPSA-N |
| XLogP | 0.82 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |