About [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride
[3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride (PubChem CID 135536936) has the molecular formula C19H18Br2ClN3O2
and a molecular weight of 515.63 g/mol. Its IUPAC name is [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride.
Molecular Properties
| Compound Name | [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride |
| PubChem CID | 135536936 |
| Molecular Formula | C19H18Br2ClN3O2 |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 512.95 |
| IUPAC Name | [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride |
| SMILES | [Cl-].[H]/N=C1\C=C(Br)C(=O)c2cc(Nc3cccc([N+](C)(C)C)c3)c(Br)c(O)c21 |
| InChI | InChI=1S/C19H17Br2N3O2.ClH/c1-24(2,3)11-6-4-5-10(7-11)23-15-8-12-16(19(26)17(15)21)14(22)9-13(20)18(12)25;/h4-9H,1-3H3,(H2-,22,23,26);1H |
| InChIKey | ZMGJTVVOOUJQFK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride?
The IUPAC name of [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride (CID 135536936) is [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride.
What is the SMILES notation for [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride?
The canonical SMILES for [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride is [Cl-].[H]/N=C1\C=C(Br)C(=O)c2cc(Nc3cccc([N+](C)(C)C)c3)c(Br)c(O)c21.
What is the InChIKey of [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride?
The InChIKey is ZMGJTVVOOUJQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Br2N3O2.ClH/c1-24(2,3)11-6-4-5-10(7-11)23-15-8-12-16(19(26)17(15)21)14(22)9-13(20)18(12)25;/h4-9H,1-3H3,(H2-,22,23,26);1H.
What are the key properties of [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride?
[3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride has a molecular weight of 515.63 g/mol, XLogP of 1.94, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium chloride is sourced from PubChem (CID 135536936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).