C8H13N5O — CID 135537086
2-amino-6,6-dimethyl-3,5,7,8-tetrahydropteridin-4-one (PubChem CID 135537086) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is 2-amino-6,6-dimethyl-3,5,7,8-tetrahydropteridin-4-one.
| Compound Name | 2-amino-6,6-dimethyl-3,5,7,8-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 135537086 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 2-amino-6,6-dimethyl-3,5,7,8-tetrahydropteridin-4-one |
| SMILES | CC1(C)CNc2nc(N)[nH]c(=O)c2N1 |
| InChI | InChI=1S/C8H13N5O/c1-8(2)3-10-5-4(13-8)6(14)12-7(9)11-5/h13H,3H2,1-2H3,(H4,9,10,11,12,14) |
| InChIKey | PAUJITBZUCOBIJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |