C13H13N5O — CID 135537205
3-[2-(2,3-dihydroinden-1-ylidene)hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135537205) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-[2-(2,3-dihydroinden-1-ylidene)hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[2-(2,3-dihydroinden-1-ylidene)hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135537205 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3-[2-(2,3-dihydroinden-1-ylidene)hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(NN=C2CCc3ccccc32)[nH]c1=O |
| InChI | InChI=1S/C13H13N5O/c1-8-12(19)14-13(17-15-8)18-16-11-7-6-9-4-2-3-5-10(9)11/h2-5H,6-7H2,1H3,(H2,14,17,18,19) |
| InChIKey | KDYGBORSQMQCCE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|