C17H14Cl2N2O4 — CID 135537853
5,7-dichloro-3-(3,4,5-trimethoxyphenyl)imino-1H-indol-2-one (PubChem CID 135537853) has the molecular formula C17H14Cl2N2O4 and a molecular weight of 381.22 g/mol. Its IUPAC name is 5,7-dichloro-3-(3,4,5-trimethoxyphenyl)imino-1H-indol-2-one.
| Compound Name | 5,7-dichloro-3-(3,4,5-trimethoxyphenyl)imino-1H-indol-2-one |
|---|---|
| PubChem CID | 135537853 |
| Molecular Formula | C17H14Cl2N2O4 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 5,7-dichloro-3-(3,4,5-trimethoxyphenyl)imino-1H-indol-2-one |
| SMILES | COc1cc(/N=C2\C(=O)Nc3c(Cl)cc(Cl)cc32)cc(OC)c1OC |
| InChI | InChI=1S/C17H14Cl2N2O4/c1-23-12-6-9(7-13(24-2)16(12)25-3)20-15-10-4-8(18)5-11(19)14(10)21-17(15)22/h4-7H,1-3H3,(H,20,21,22) |
| InChIKey | FUEBOJGVXAUOPO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|