About (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide
(2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide (PubChem CID 135538007) has the molecular formula C4H8N4O3
and a molecular weight of 160.13 g/mol. Its IUPAC name is (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide.
Molecular Properties
| Compound Name | (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide |
| PubChem CID | 135538007 |
| Molecular Formula | C4H8N4O3 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide |
| SMILES | CC(=N\O)/C(=N\O)C(/N)=N\O |
| InChI | InChI=1S/C4H8N4O3/c1-2(6-9)3(7-10)4(5)8-11/h9-11H,1H3,(H2,5,8)/b6-2+,7-3+ |
| InChIKey | DLZXYOQCRWMQOL-YPCIICBESA-N |
| XLogP | -0.59 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide?
The IUPAC name of (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide (CID 135538007) is (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide.
What is the SMILES notation for (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide?
The canonical SMILES for (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide is CC(=N\O)/C(=N\O)C(/N)=N\O.
What is the InChIKey of (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide?
The InChIKey is DLZXYOQCRWMQOL-YPCIICBESA-N. The full InChI is InChI=1S/C4H8N4O3/c1-2(6-9)3(7-10)4(5)8-11/h9-11H,1H3,(H2,5,8)/b6-2+,7-3+.
What are the key properties of (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide?
(2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide has a molecular weight of 160.13 g/mol, XLogP of -0.59, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-N'-hydroxy-2,3-bis(hydroxyimino)butanimidamide is sourced from PubChem (CID 135538007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).