C27H23N6O3+ — CID 135538478
2-ethyl-3-methyl-1-[2-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methylidene]hydrazinyl]-5H-pyrido[1,2-a]benzimidazol-10-ium-4-carbonitrile (PubChem CID 135538478) has the molecular formula C27H23N6O3+ and a molecular weight of 479.52 g/mol. Its IUPAC name is 2-ethyl-3-methyl-1-[2-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methylidene]hydrazinyl]-5H-pyrido[1,2-a]benzimidazol-10-ium-4-carbonitrile.
| Compound Name | 2-ethyl-3-methyl-1-[2-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methylidene]hydrazinyl]-5H-pyrido[1,2-a]benzimidazol-10-ium-4-carbonitrile |
|---|---|
| PubChem CID | 135538478 |
| Molecular Formula | C27H23N6O3+ |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-ethyl-3-methyl-1-[2-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methylidene]hydrazinyl]-5H-pyrido[1,2-a]benzimidazol-10-ium-4-carbonitrile |
| SMILES | CCc1c(C)c(C#N)c2[nH]c3ccccc3[n+]2c1NN=Cc1cc2cc3c(cc2[nH]c1=O)OCCO3 |
| InChI | InChI=1S/C27H22N6O3/c1-3-18-15(2)19(13-28)25-30-20-6-4-5-7-22(20)33(25)26(18)32-29-14-17-10-16-11-23-24(36-9-8-35-23)12-21(16)31-27(17)34/h4-7,10-12,14H,3,8-9H2,1-2H3,(H2,29,30,31,32,34)/p+1 |
| InChIKey | NWXVXDHDDKTQAJ-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|