C17H14N2O8 — CID 135538637
trimethyl 4,5-dihydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate (PubChem CID 135538637) has the molecular formula C17H14N2O8 and a molecular weight of 374.31 g/mol. Its IUPAC name is trimethyl 4,5-dihydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate.
| Compound Name | trimethyl 4,5-dihydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate |
|---|---|
| PubChem CID | 135538637 |
| Molecular Formula | C17H14N2O8 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | trimethyl 4,5-dihydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate |
| SMILES | COC(=O)c1cc2c(O)c(O)c3[nH]c(C(=O)OC)cc(C(=O)OC)c3c2n1 |
| InChI | InChI=1S/C17H14N2O8/c1-25-15(22)6-4-8(16(23)26-2)19-12-10(6)11-7(13(20)14(12)21)5-9(18-11)17(24)27-3/h4-5,19-21H,1-3H3 |
| InChIKey | ILOXSQOGEFOULU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 148.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|