C8H9N3O — CID 135538831
3,4-dimethyl-2,7-dihydropyrazolo[3,4-b]pyridin-6-one (PubChem CID 135538831) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 3,4-dimethyl-2,7-dihydropyrazolo[3,4-b]pyridin-6-one.
| Compound Name | 3,4-dimethyl-2,7-dihydropyrazolo[3,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135538831 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 3,4-dimethyl-2,7-dihydropyrazolo[3,4-b]pyridin-6-one |
| SMILES | Cc1cc(=O)[nH]c2n[nH]c(C)c12 |
| InChI | InChI=1S/C8H9N3O/c1-4-3-6(12)9-8-7(4)5(2)10-11-8/h3H,1-2H3,(H2,9,10,11,12) |
| InChIKey | VBJUXTFHVXFEEZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |