C20H28N6O4S — CID 135539056
4-ethoxy-N-[2-(methylamino)ethyl]-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)benzenesulfonamide (PubChem CID 135539056) has the molecular formula C20H28N6O4S and a molecular weight of 448.55 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(methylamino)ethyl]-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[2-(methylamino)ethyl]-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135539056 |
| Molecular Formula | C20H28N6O4S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 4-ethoxy-N-[2-(methylamino)ethyl]-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-5-yl)benzenesulfonamide |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)NCCNC)ccc3OCC)nc12 |
| InChI | InChI=1S/C20H28N6O4S/c1-5-7-15-17-18(26(4)25-15)20(27)24-19(23-17)14-12-13(8-9-16(14)30-6-2)31(28,29)22-11-10-21-3/h8-9,12,21-22H,5-7,10-11H2,1-4H3,(H,23,24,27) |
| InChIKey | DBBKIQJKMPUJFA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|